CYTOP(R) 341
Tri-i-butylphosphine
CAS: 4125-25-1
Molecular Formula: C12H27P
CYTOP(R) 341 - Names and Identifiers
| Name | Tri-i-butylphosphine |
| Synonyms | CYTOP(R) 341 TRIISOBUTYLPHOSPHINE Triisobutylphosphine Tri-i-butylphosphine TRI-I-BUTYLPHOSPHINE Triibutylphosphinemin tris(2-methylpropyl)phosphane TRIS(2-METHYLPROPYL)PHOSPHINE Tris(2-methylpropyl) phosphine Phosphine, tris(2-methylpropyl)- TRIISOBUTYLPHOSPHINE (CYTOP 341) CYTEC QUALITY |
| CAS | 4125-25-1 |
| EINECS | 223-934-2 |
| InChI | InChI=1/C12H27P/c1-10(2)7-13(8-11(3)4)9-12(5)6/h10-12H,7-9H2,1-6H3 |
CYTOP(R) 341 - Physico-chemical Properties
| Molecular Formula | C12H27P |
| Molar Mass | 202.32 |
| Density | 0.811g/mLat 25°C(lit.) |
| Boling Point | 126°C50mm Hg(lit.) |
| Flash Point | 50°F |
| Vapor Presure | 0.0524mmHg at 25°C |
| Appearance | liquid |
| Color | colorless to light yellow |
| Sensitive | air sensitive |
| Refractive Index | n20/D 1.451(lit.) |
CYTOP(R) 341 - Risk and Safety
| Risk Codes | R17 - Spontaneously flammable in air R20/21/22 - Harmful by inhalation, in contact with skin and if swallowed. R34 - Causes burns |
| Safety Description | S16 - Keep away from sources of ignition. S23 - Do not breathe vapour. S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S45 - In case of accident or if you feel unwell, seek medical advice immediately (show the label whenever possible.) |
| UN IDs | UN 2845 4.2/PG 1 |
| WGK Germany | 3 |
| FLUKA BRAND F CODES | 10-13-23 |
CYTOP(R) 341 - Introduction
Tri-i-butylphosphine is an organophosphorus compound with the chemical formula (C4H9)3P. The following is a description of the nature, use, manufacture and safety information of the Tri-i-butylphosphine:
Nature:
1. appearance: colorless liquid.
2. density: low, about 0.76 g/mL.
3. melting point: about -78 ℃.
4. Boiling point: about 136-138 ℃.
5. Solubility: Soluble in organic solvents, such as alcohols and ethers.
Use:
1. Catalyst: Tri-i-butylphosphine is commonly used as a catalyst in organic synthesis reactions, such as hydrogenation, alkylation and addition reactions.
2. Ligands: Tri-i-butylphosphine can form complexes with transition metals and participate in the synthesis of catalysts and organic synthesis reactions as ligands.
3. Reducing agent: Tri-i-butylphosphine can be used as a reducing agent in organic synthesis, for example, in the reduction of aldehydes, ketones and olefins.
Preparation Method:
The general method for preparing Tri-i-butylphosphine is obtained by reacting phosphorus trichloride with isobutyl lithium. During the reaction, attention should be paid to the operation protection and the use of inert atmosphere to ensure safety.
Safety Information:
1. Tri-i-butylphosphine has an irritating effect on the skin and eyes, rinse with plenty of water immediately after contact.
2. The container should be sealed during operation to avoid inhalation of gas and contact with skin.
3. should be operated in a well-ventilated place to avoid adverse toxic effects.
4. Avoid contact with flammable materials and store in a cool and dry place.
Nature:
1. appearance: colorless liquid.
2. density: low, about 0.76 g/mL.
3. melting point: about -78 ℃.
4. Boiling point: about 136-138 ℃.
5. Solubility: Soluble in organic solvents, such as alcohols and ethers.
Use:
1. Catalyst: Tri-i-butylphosphine is commonly used as a catalyst in organic synthesis reactions, such as hydrogenation, alkylation and addition reactions.
2. Ligands: Tri-i-butylphosphine can form complexes with transition metals and participate in the synthesis of catalysts and organic synthesis reactions as ligands.
3. Reducing agent: Tri-i-butylphosphine can be used as a reducing agent in organic synthesis, for example, in the reduction of aldehydes, ketones and olefins.
Preparation Method:
The general method for preparing Tri-i-butylphosphine is obtained by reacting phosphorus trichloride with isobutyl lithium. During the reaction, attention should be paid to the operation protection and the use of inert atmosphere to ensure safety.
Safety Information:
1. Tri-i-butylphosphine has an irritating effect on the skin and eyes, rinse with plenty of water immediately after contact.
2. The container should be sealed during operation to avoid inhalation of gas and contact with skin.
3. should be operated in a well-ventilated place to avoid adverse toxic effects.
4. Avoid contact with flammable materials and store in a cool and dry place.
Last Update：2024-04-10 22:29:15
